C16H23BrN2O2 — CID 102767577
methyl 3-bromo-4-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]benzoate (PubChem CID 102767577) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is methyl 3-bromo-4-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 102767577 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | methyl 3-bromo-4-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)C2CCCN(C)C2)c(Br)c1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-18-8-4-5-14(11-18)19(2)10-13-7-6-12(9-15(13)17)16(20)21-3/h6-7,9,14H,4-5,8,10-11H2,1-3H3 |
| InChIKey | FQIFXUFQIZYTSE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |