methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate

C13H14BrF2NO2 — CID 169410384

IUPACmethyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(Br)c(CN2CCC(F)(F)C2)c1
InChIInChI=1S/C13H14BrF2NO2/c1-19-12(18)9-2-3-11(14)10(6-9)7-17-5-4-13(15,16)8-17/h2-3,6H,4-5,7-8H2,1H3
InChIKeyHARCYIWXTRJTBC-UHFFFAOYSA-N
MW334.16 g/mol
LogP3.08
Rot. Bonds3

About methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate

methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate (PubChem CID 169410384) has the molecular formula C13H14BrF2NO2 and a molecular weight of 334.16 g/mol. Its IUPAC name is methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate.

Molecular Properties

Compound Namemethyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate
PubChem CID169410384
Molecular FormulaC13H14BrF2NO2
Molecular Weight334.16 g/mol
Exact Mass333.02
IUPAC Namemethyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(Br)c(CN2CCC(F)(F)C2)c1
InChIInChI=1S/C13H14BrF2NO2/c1-19-12(18)9-2-3-11(14)10(6-9)7-17-5-4-13(15,16)8-17/h2-3,6H,4-5,7-8H2,1H3
InChIKeyHARCYIWXTRJTBC-UHFFFAOYSA-N
XLogP3.08
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.16
LogP ≤ 53.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate?
The IUPAC name of methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate (CID 169410384) is methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate.
What is the SMILES notation for methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate?
The canonical SMILES for methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate is COC(=O)c1ccc(Br)c(CN2CCC(F)(F)C2)c1.
What is the InChIKey of methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate?
The InChIKey is HARCYIWXTRJTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrF2NO2/c1-19-12(18)9-2-3-11(14)10(6-9)7-17-5-4-13(15,16)8-17/h2-3,6H,4-5,7-8H2,1H3.
What are the key properties of methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate?
methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate has a molecular weight of 334.16 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-3-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoate is sourced from PubChem (CID 169410384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).