3-nitro-4-pentylbenzoyl chloride

C12H14ClNO3 — CID 21484502

IUPAC3-nitro-4-pentylbenzoyl chloride
SMILESCCCCCc1ccc(C(=O)Cl)cc1[N+](=O)[O-]
InChIInChI=1S/C12H14ClNO3/c1-2-3-4-5-9-6-7-10(12(13)15)8-11(9)14(16)17/h6-8H,2-5H2,1H3
InChIKeyKVDTZGHQLMVNGW-UHFFFAOYSA-N
MW255.70 g/mol
LogP3.71
Rot. Bonds6

About 3-nitro-4-pentylbenzoyl chloride

3-nitro-4-pentylbenzoyl chloride (PubChem CID 21484502) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 3-nitro-4-pentylbenzoyl chloride.

Molecular Properties

Compound Name3-nitro-4-pentylbenzoyl chloride
PubChem CID21484502
Molecular FormulaC12H14ClNO3
Molecular Weight255.70 g/mol
Exact Mass255.07
IUPAC Name3-nitro-4-pentylbenzoyl chloride
SMILESCCCCCc1ccc(C(=O)Cl)cc1[N+](=O)[O-]
InChIInChI=1S/C12H14ClNO3/c1-2-3-4-5-9-6-7-10(12(13)15)8-11(9)14(16)17/h6-8H,2-5H2,1H3
InChIKeyKVDTZGHQLMVNGW-UHFFFAOYSA-N
XLogP3.71
TPSA60.21 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.70
LogP ≤ 53.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-nitro-4-pentylbenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-nitro-4-pentylbenzoyl chloride?
The IUPAC name of 3-nitro-4-pentylbenzoyl chloride (CID 21484502) is 3-nitro-4-pentylbenzoyl chloride.
What is the SMILES notation for 3-nitro-4-pentylbenzoyl chloride?
The canonical SMILES for 3-nitro-4-pentylbenzoyl chloride is CCCCCc1ccc(C(=O)Cl)cc1[N+](=O)[O-].
What is the InChIKey of 3-nitro-4-pentylbenzoyl chloride?
The InChIKey is KVDTZGHQLMVNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO3/c1-2-3-4-5-9-6-7-10(12(13)15)8-11(9)14(16)17/h6-8H,2-5H2,1H3.
What are the key properties of 3-nitro-4-pentylbenzoyl chloride?
3-nitro-4-pentylbenzoyl chloride has a molecular weight of 255.70 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-4-pentylbenzoyl chloride is sourced from PubChem (CID 21484502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).