About 3-nitro-4-propoxybenzoyl chloride
3-nitro-4-propoxybenzoyl chloride (PubChem CID 95732806) has the molecular formula C10H10ClNO4
and a molecular weight of 243.65 g/mol. Its IUPAC name is 3-nitro-4-propoxybenzoyl chloride.
Molecular Properties
| Compound Name | 3-nitro-4-propoxybenzoyl chloride |
| PubChem CID | 95732806 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 3-nitro-4-propoxybenzoyl chloride |
| SMILES | CCCOc1ccc(C(=O)Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10ClNO4/c1-2-5-16-9-4-3-7(10(11)13)6-8(9)12(14)15/h3-4,6H,2,5H2,1H3 |
| InChIKey | XXVAIWCLFHKSBK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-4-propoxybenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-4-propoxybenzoyl chloride?
The IUPAC name of 3-nitro-4-propoxybenzoyl chloride (CID 95732806) is 3-nitro-4-propoxybenzoyl chloride.
What is the SMILES notation for 3-nitro-4-propoxybenzoyl chloride?
The canonical SMILES for 3-nitro-4-propoxybenzoyl chloride is CCCOc1ccc(C(=O)Cl)cc1[N+](=O)[O-].
What is the InChIKey of 3-nitro-4-propoxybenzoyl chloride?
The InChIKey is XXVAIWCLFHKSBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO4/c1-2-5-16-9-4-3-7(10(11)13)6-8(9)12(14)15/h3-4,6H,2,5H2,1H3.
What are the key properties of 3-nitro-4-propoxybenzoyl chloride?
3-nitro-4-propoxybenzoyl chloride has a molecular weight of 243.65 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-4-propoxybenzoyl chloride is sourced from PubChem (CID 95732806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).