C32H36Cl2O2 — CID 54457056
4-[4-(4-carbonochloridoylphenyl)-2,5-dihexylphenyl]benzoyl chloride (PubChem CID 54457056) has the molecular formula C32H36Cl2O2 and a molecular weight of 523.54 g/mol. Its IUPAC name is 4-[4-(4-carbonochloridoylphenyl)-2,5-dihexylphenyl]benzoyl chloride.
| Compound Name | 4-[4-(4-carbonochloridoylphenyl)-2,5-dihexylphenyl]benzoyl chloride |
|---|---|
| PubChem CID | 54457056 |
| Molecular Formula | C32H36Cl2O2 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 4-[4-(4-carbonochloridoylphenyl)-2,5-dihexylphenyl]benzoyl chloride |
| SMILES | CCCCCCc1cc(-c2ccc(C(=O)Cl)cc2)c(CCCCCC)cc1-c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C32H36Cl2O2/c1-3-5-7-9-11-27-21-30(24-15-19-26(20-16-24)32(34)36)28(12-10-8-6-4-2)22-29(27)23-13-17-25(18-14-23)31(33)35/h13-22H,3-12H2,1-2H3 |
| InChIKey | WYXZHKFHGMFQRS-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|