2-tetradecylpyridine-4-carbonyl chloride

C20H32ClNO — CID 154124340

IUPAC2-tetradecylpyridine-4-carbonyl chloride
SMILESCCCCCCCCCCCCCCc1cc(C(=O)Cl)ccn1
InChIInChI=1S/C20H32ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-17-18(20(21)23)15-16-22-19/h15-17H,2-14H2,1H3
InChIKeyMIVHEOFEWFUVGH-UHFFFAOYSA-N
MW337.94 g/mol
LogP6.70
Rot. Bonds14

About 2-tetradecylpyridine-4-carbonyl chloride

2-tetradecylpyridine-4-carbonyl chloride (PubChem CID 154124340) has the molecular formula C20H32ClNO and a molecular weight of 337.94 g/mol. Its IUPAC name is 2-tetradecylpyridine-4-carbonyl chloride.

Molecular Properties

Compound Name2-tetradecylpyridine-4-carbonyl chloride
PubChem CID154124340
Molecular FormulaC20H32ClNO
Molecular Weight337.94 g/mol
Exact Mass337.22
IUPAC Name2-tetradecylpyridine-4-carbonyl chloride
SMILESCCCCCCCCCCCCCCc1cc(C(=O)Cl)ccn1
InChIInChI=1S/C20H32ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-17-18(20(21)23)15-16-22-19/h15-17H,2-14H2,1H3
InChIKeyMIVHEOFEWFUVGH-UHFFFAOYSA-N
XLogP6.70
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds14
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500337.94
LogP ≤ 56.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-tetradecylpyridine-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-tetradecylpyridine-4-carbonyl chloride?
The IUPAC name of 2-tetradecylpyridine-4-carbonyl chloride (CID 154124340) is 2-tetradecylpyridine-4-carbonyl chloride.
What is the SMILES notation for 2-tetradecylpyridine-4-carbonyl chloride?
The canonical SMILES for 2-tetradecylpyridine-4-carbonyl chloride is CCCCCCCCCCCCCCc1cc(C(=O)Cl)ccn1.
What is the InChIKey of 2-tetradecylpyridine-4-carbonyl chloride?
The InChIKey is MIVHEOFEWFUVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-17-18(20(21)23)15-16-22-19/h15-17H,2-14H2,1H3.
What are the key properties of 2-tetradecylpyridine-4-carbonyl chloride?
2-tetradecylpyridine-4-carbonyl chloride has a molecular weight of 337.94 g/mol, XLogP of 6.70, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tetradecylpyridine-4-carbonyl chloride is sourced from PubChem (CID 154124340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).