C19H27N — CID 123193848
4-(5,6-dimethylhepta-1,4,6-trien-2-yl)-2-pentylpyridine (PubChem CID 123193848) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-(5,6-dimethylhepta-1,4,6-trien-2-yl)-2-pentylpyridine.
| Compound Name | 4-(5,6-dimethylhepta-1,4,6-trien-2-yl)-2-pentylpyridine |
|---|---|
| PubChem CID | 123193848 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 4-(5,6-dimethylhepta-1,4,6-trien-2-yl)-2-pentylpyridine |
| SMILES | C=C(C)C(C)=CCC(=C)c1ccnc(CCCCC)c1 |
| InChI | InChI=1S/C19H27N/c1-6-7-8-9-19-14-18(12-13-20-19)17(5)11-10-16(4)15(2)3/h10,12-14H,2,5-9,11H2,1,3-4H3 |
| InChIKey | PHPFGFGIIBEYJK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|