C50H72N4O4 — CID 177430922
CID 177430922 (PubChem CID 177430922) has the molecular formula C50H72N4O4 and a molecular weight of 793.15 g/mol.
| Compound Name | CID 177430922 |
|---|---|
| PubChem CID | 177430922 |
| Molecular Formula | C50H72N4O4 |
| Molecular Weight | 793.15 g/mol |
| Exact Mass | 792.56 |
| IUPAC Name | — |
| SMILES | CCCCCCc1cc(-c2ccc(C(=O)NC3CC(C)(C)N([O])C(C)(C)C3)cc2)c(CCCCCC)cc1-c1ccc(C(=O)NC2CC(C)(C)N([O])C(C)(C)C2)cc1 |
| InChI | InChI=1S/C50H72N4O4/c1-11-13-15-17-19-39-29-44(36-23-27-38(28-24-36)46(56)52-42-33-49(7,8)54(58)50(9,10)34-42)40(20-18-16-14-12-2)30-43(39)35-21-25-37(26-22-35)45(55)51-41-31-47(3,4)53(57)48(5,6)32-41/h21-30,41-42H,11-20,31-34H2,1-10H3,(H,51,55)(H,52,56) |
| InChIKey | WVACGMYSSTUHQF-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 104.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.15 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|