C43H39N2O2 — CID 101468215
CID 101468215 (PubChem CID 101468215) has the molecular formula C43H39N2O2 and a molecular weight of 615.80 g/mol.
| Compound Name | CID 101468215 |
|---|---|
| PubChem CID | 101468215 |
| Molecular Formula | C43H39N2O2 |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)c2ccc(C(=C3c4ccccc4-c4ccccc43)C3c4ccccc4-c4ccccc43)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C43H39N2O2/c1-42(2)25-29(26-43(3,4)45(42)47)44-41(46)28-23-21-27(22-24-28)38(39-34-17-9-5-13-30(34)31-14-6-10-18-35(31)39)40-36-19-11-7-15-32(36)33-16-8-12-20-37(33)40/h5-24,29,39H,25-26H2,1-4H3,(H,44,46) |
| InChIKey | OFWGVSOIMWIQPD-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 52.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|