C32H48N4O4 — CID 142858846
2-N,6-N-bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-2,6-dicarboxamide (PubChem CID 142858846) has the molecular formula C32H48N4O4 and a molecular weight of 552.76 g/mol. Its IUPAC name is 2-N,6-N-bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 142858846 |
| Molecular Formula | C32H48N4O4 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | 2-N,6-N-bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-2,6-dicarboxamide |
| SMILES | CON1C(C)(C)CC(NC(=O)c2ccc3cc(C(=O)NC4CC(C)(C)N(OC)C(C)(C)C4)ccc3c2)CC1(C)C |
| InChI | InChI=1S/C32H48N4O4/c1-29(2)17-25(18-30(3,4)35(29)39-9)33-27(37)23-13-11-22-16-24(14-12-21(22)15-23)28(38)34-26-19-31(5,6)36(40-10)32(7,8)20-26/h11-16,25-26H,17-20H2,1-10H3,(H,33,37)(H,34,38) |
| InChIKey | PNQGHXRHAZGLTI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |