C52H84N8O4 — CID 158461970
1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxamide (PubChem CID 158461970) has the molecular formula C52H84N8O4 and a molecular weight of 885.30 g/mol. Its IUPAC name is 1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 158461970 |
| Molecular Formula | C52H84N8O4 |
| Molecular Weight | 885.30 g/mol |
| Exact Mass | 884.66 |
| IUPAC Name | 1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxamide |
| SMILES | CC1(C)CC(NC(=O)c2cccc(C(=O)NC3CC(C)(C)NC(C)(C)C3)c2)CC(C)(C)N1.CC1(C)CC(NC(=O)c2cccc(C(=O)NC3CC(C)(C)NC(C)(C)C3)c2)CC(C)(C)N1 |
| InChI | InChI=1S/2C26H42N4O2/c2*1-23(2)13-19(14-24(3,4)29-23)27-21(31)17-10-9-11-18(12-17)22(32)28-20-15-25(5,6)30-26(7,8)16-20/h2*9-12,19-20,29-30H,13-16H2,1-8H3,(H,27,31)(H,28,32) |
| InChIKey | HFHDWXCMRITCLU-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 164.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.30 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |