C25H35N3O — CID 84556584
3-[(2-ethylanilino)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 84556584) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 3-[(2-ethylanilino)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 3-[(2-ethylanilino)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 84556584 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 3-[(2-ethylanilino)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CCc1ccccc1NCc1cccc(C(=O)NC2CC(C)(C)NC(C)(C)C2)c1 |
| InChI | InChI=1S/C25H35N3O/c1-6-19-11-7-8-13-22(19)26-17-18-10-9-12-20(14-18)23(29)27-21-15-24(2,3)28-25(4,5)16-21/h7-14,21,26,28H,6,15-17H2,1-5H3,(H,27,29) |
| InChIKey | XICULAJLTKIXGK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |