C24H26N2O — CID 84554469
N-(2,5-dimethylphenyl)-3-[(2-ethylanilino)methyl]benzamide (PubChem CID 84554469) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-[(2-ethylanilino)methyl]benzamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-[(2-ethylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 84554469 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-[(2-ethylanilino)methyl]benzamide |
| SMILES | CCc1ccccc1NCc1cccc(C(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H26N2O/c1-4-20-9-5-6-11-22(20)25-16-19-8-7-10-21(15-19)24(27)26-23-14-17(2)12-13-18(23)3/h5-15,25H,4,16H2,1-3H3,(H,26,27) |
| InChIKey | MIBAVTFPELSOTQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |