C23H21N3OS — CID 84554554
[4-[[3-[(2-ethylanilino)methyl]benzoyl]amino]phenyl] thiocyanate (PubChem CID 84554554) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is [4-[[3-[(2-ethylanilino)methyl]benzoyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[3-[(2-ethylanilino)methyl]benzoyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 84554554 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [4-[[3-[(2-ethylanilino)methyl]benzoyl]amino]phenyl] thiocyanate |
| SMILES | CCc1ccccc1NCc1cccc(C(=O)Nc2ccc(SC#N)cc2)c1 |
| InChI | InChI=1S/C23H21N3OS/c1-2-18-7-3-4-9-22(18)25-15-17-6-5-8-19(14-17)23(27)26-20-10-12-21(13-11-20)28-16-24/h3-14,25H,2,15H2,1H3,(H,26,27) |
| InChIKey | WMLNHJFDPGDCNL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|