C27H30N2O3 — CID 84554578
butyl 3-[[3-[(2-ethylanilino)methyl]benzoyl]amino]benzoate (PubChem CID 84554578) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is butyl 3-[[3-[(2-ethylanilino)methyl]benzoyl]amino]benzoate.
| Compound Name | butyl 3-[[3-[(2-ethylanilino)methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 84554578 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | butyl 3-[[3-[(2-ethylanilino)methyl]benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)c2cccc(CNc3ccccc3CC)c2)c1 |
| InChI | InChI=1S/C27H30N2O3/c1-3-5-16-32-27(31)23-13-9-14-24(18-23)29-26(30)22-12-8-10-20(17-22)19-28-25-15-7-6-11-21(25)4-2/h6-15,17-18,28H,3-5,16,19H2,1-2H3,(H,29,30) |
| InChIKey | BGHUSMKPPJPDBF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|