C24H25N3O2 — CID 84554547
N-(3-acetamidophenyl)-3-[(2-ethylanilino)methyl]benzamide (PubChem CID 84554547) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-3-[(2-ethylanilino)methyl]benzamide.
| Compound Name | N-(3-acetamidophenyl)-3-[(2-ethylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 84554547 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(3-acetamidophenyl)-3-[(2-ethylanilino)methyl]benzamide |
| SMILES | CCc1ccccc1NCc1cccc(C(=O)Nc2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-3-19-9-4-5-13-23(19)25-16-18-8-6-10-20(14-18)24(29)27-22-12-7-11-21(15-22)26-17(2)28/h4-15,25H,3,16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | JSRWVRUBJMPLJI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |