C22H23N3O3S — CID 84554523
3-[(2-ethylanilino)methyl]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 84554523) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-[(2-ethylanilino)methyl]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 3-[(2-ethylanilino)methyl]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 84554523 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[(2-ethylanilino)methyl]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CCc1ccccc1NCc1cccc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-2-17-7-3-4-9-21(17)24-15-16-6-5-8-18(14-16)22(26)25-19-10-12-20(13-11-19)29(23,27)28/h3-14,24H,2,15H2,1H3,(H,25,26)(H2,23,27,28) |
| InChIKey | OGLCNWBWPKCAMU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |