C19H22N2O4 — CID 84556600
2-[[3-[(2-ethylanilino)methyl]benzoyl]amino]-3-hydroxypropanoic acid (PubChem CID 84556600) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[[3-[(2-ethylanilino)methyl]benzoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[3-[(2-ethylanilino)methyl]benzoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 84556600 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[[3-[(2-ethylanilino)methyl]benzoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCc1ccccc1NCc1cccc(C(=O)NC(CO)C(=O)O)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-2-14-7-3-4-9-16(14)20-11-13-6-5-8-15(10-13)18(23)21-17(12-22)19(24)25/h3-10,17,20,22H,2,11-12H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | KVCJVPVQXIUTHP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |