C24H35N3O — CID 84556601
N-[4-(diethylamino)butyl]-3-[(2-ethylanilino)methyl]benzamide (PubChem CID 84556601) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is N-[4-(diethylamino)butyl]-3-[(2-ethylanilino)methyl]benzamide.
| Compound Name | N-[4-(diethylamino)butyl]-3-[(2-ethylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 84556601 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | N-[4-(diethylamino)butyl]-3-[(2-ethylanilino)methyl]benzamide |
| SMILES | CCc1ccccc1NCc1cccc(C(=O)NCCCCN(CC)CC)c1 |
| InChI | InChI=1S/C24H35N3O/c1-4-21-13-7-8-15-23(21)26-19-20-12-11-14-22(18-20)24(28)25-16-9-10-17-27(5-2)6-3/h7-8,11-15,18,26H,4-6,9-10,16-17,19H2,1-3H3,(H,25,28) |
| InChIKey | VQKLCEMMQKPDBL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|