C24H30N2O — CID 18316782
(E)-1,3-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-en-1-one (PubChem CID 18316782) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is (E)-1,3-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-en-1-one.
| Compound Name | (E)-1,3-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-en-1-one |
|---|---|
| PubChem CID | 18316782 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (E)-1,3-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-en-1-one |
| SMILES | CC1(C)CC(N/C(=C/C(=O)c2ccccc2)c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H30N2O/c1-23(2)16-20(17-24(3,4)26-23)25-21(18-11-7-5-8-12-18)15-22(27)19-13-9-6-10-14-19/h5-15,20,25-26H,16-17H2,1-4H3/b21-15+ |
| InChIKey | TXCUNIGPVVWVEL-RCCKNPSSSA-N |
| XLogP | 4.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|