C21H23NO — CID 6186115
(E)-3-(cyclohexylamino)-1,3-diphenylprop-2-en-1-one (PubChem CID 6186115) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (E)-3-(cyclohexylamino)-1,3-diphenylprop-2-en-1-one.
| Compound Name | (E)-3-(cyclohexylamino)-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6186115 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (E)-3-(cyclohexylamino)-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C(/NC1CCCCC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22-19-14-8-3-9-15-19/h1-2,4-7,10-13,16,19,22H,3,8-9,14-15H2/b20-16+ |
| InChIKey | IUTIZUOAIKETPK-CAPFRKAQSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|