C23H28N2O — CID 70543952
(Z)-3-(3-aminophenyl)-N-cyclooctyl-3-phenylprop-2-enamide (PubChem CID 70543952) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (Z)-3-(3-aminophenyl)-N-cyclooctyl-3-phenylprop-2-enamide.
| Compound Name | (Z)-3-(3-aminophenyl)-N-cyclooctyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 70543952 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (Z)-3-(3-aminophenyl)-N-cyclooctyl-3-phenylprop-2-enamide |
| SMILES | Nc1cccc(/C(=C\C(=O)NC2CCCCCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H28N2O/c24-20-13-9-12-19(16-20)22(18-10-5-4-6-11-18)17-23(26)25-21-14-7-2-1-3-8-15-21/h4-6,9-13,16-17,21H,1-3,7-8,14-15,24H2,(H,25,26)/b22-17- |
| InChIKey | CKUBRUCAMLQFAR-XLNRJJMWSA-N |
| XLogP | 4.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|