C22H25N — CID 174416456
N-(1,4-diphenylbuta-1,3-dienyl)cyclohexanamine (PubChem CID 174416456) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is N-(1,4-diphenylbuta-1,3-dienyl)cyclohexanamine.
| Compound Name | N-(1,4-diphenylbuta-1,3-dienyl)cyclohexanamine |
|---|---|
| PubChem CID | 174416456 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N-(1,4-diphenylbuta-1,3-dienyl)cyclohexanamine |
| SMILES | C(=Cc1ccccc1)C=C(NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C22H25N/c1-4-11-19(12-5-1)13-10-18-22(20-14-6-2-7-15-20)23-21-16-8-3-9-17-21/h1-2,4-7,10-15,18,21,23H,3,8-9,16-17H2 |
| InChIKey | YXJYPQRIFDJKQB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|