C20H23N — CID 174419746
N-tert-butyl-1,4-diphenylbuta-1,3-dien-1-amine (PubChem CID 174419746) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-tert-butyl-1,4-diphenylbuta-1,3-dien-1-amine.
| Compound Name | N-tert-butyl-1,4-diphenylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 174419746 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-tert-butyl-1,4-diphenylbuta-1,3-dien-1-amine |
| SMILES | CC(C)(C)NC(=CC=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-20(2,3)21-19(18-14-8-5-9-15-18)16-10-13-17-11-6-4-7-12-17/h4-16,21H,1-3H3 |
| InChIKey | NJEPLSQALXFCLH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|