C17H14O — CID 173316530
2,5-diphenylpenta-2,4-dienal (PubChem CID 173316530) has the molecular formula C17H14O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2,5-diphenylpenta-2,4-dienal.
| Compound Name | 2,5-diphenylpenta-2,4-dienal |
|---|---|
| PubChem CID | 173316530 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2,5-diphenylpenta-2,4-dienal |
| SMILES | O=CC(=CC=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14O/c18-14-17(16-11-5-2-6-12-16)13-7-10-15-8-3-1-4-9-15/h1-14H |
| InChIKey | NMKYHKHTKJRUMQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|