C18H16 — CID 145204139
[(1Z,3E)-4-phenylhexa-1,3,5-trienyl]benzene (PubChem CID 145204139) has the molecular formula C18H16 and a molecular weight of 232.33 g/mol. Its IUPAC name is [(1Z,3E)-4-phenylhexa-1,3,5-trienyl]benzene.
| Compound Name | [(1Z,3E)-4-phenylhexa-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 145204139 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [(1Z,3E)-4-phenylhexa-1,3,5-trienyl]benzene |
| SMILES | C=C/C(=C\C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16/c1-2-17(18-13-7-4-8-14-18)15-9-12-16-10-5-3-6-11-16/h2-15H,1H2/b12-9-,17-15+ |
| InChIKey | IKRUXRODDOAJKM-AWGMXQMZSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|