C13H11N — CID 12034343
(2Z,4E)-2-ethenyl-5-phenylpenta-2,4-dienenitrile (PubChem CID 12034343) has the molecular formula C13H11N and a molecular weight of 181.24 g/mol. Its IUPAC name is (2Z,4E)-2-ethenyl-5-phenylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-ethenyl-5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 12034343 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2Z,4E)-2-ethenyl-5-phenylpenta-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H11N/c1-2-12(11-14)9-6-10-13-7-4-3-5-8-13/h2-10H,1H2/b10-6+,12-9- |
| InChIKey | VEHAOWVVSNZBIY-CQJQESKGSA-N |
| XLogP | 3.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|