C18H16N2 — CID 173209079
2-(benzylamino)-5-phenylpenta-2,4-dienenitrile (PubChem CID 173209079) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(benzylamino)-5-phenylpenta-2,4-dienenitrile.
| Compound Name | 2-(benzylamino)-5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 173209079 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(benzylamino)-5-phenylpenta-2,4-dienenitrile |
| SMILES | N#CC(=CC=Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C18H16N2/c19-14-18(20-15-17-10-5-2-6-11-17)13-7-12-16-8-3-1-4-9-16/h1-13,20H,15H2 |
| InChIKey | BJCXTJNPOUPXCW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|