C20H18N2O2 — CID 2351530
(2Z,4E)-N-benzyl-2-cyano-5-(2-methoxyphenyl)penta-2,4-dienamide (PubChem CID 2351530) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2Z,4E)-N-benzyl-2-cyano-5-(2-methoxyphenyl)penta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-benzyl-2-cyano-5-(2-methoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 2351530 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (2Z,4E)-N-benzyl-2-cyano-5-(2-methoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1ccccc1/C=C/C=C(/C#N)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H18N2O2/c1-24-19-13-6-5-10-17(19)11-7-12-18(14-21)20(23)22-15-16-8-3-2-4-9-16/h2-13H,15H2,1H3,(H,22,23)/b11-7+,18-12- |
| InChIKey | GGNCBOUKLCEMBO-VVJRFBLUSA-N |
| XLogP | 3.47 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|