C20H17FN2O3 — CID 11696025
(2E,4E)-2-cyano-N-[(3-fluorophenyl)methyl]-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide (PubChem CID 11696025) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is (2E,4E)-2-cyano-N-[(3-fluorophenyl)methyl]-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-2-cyano-N-[(3-fluorophenyl)methyl]-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 11696025 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (2E,4E)-2-cyano-N-[(3-fluorophenyl)methyl]-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1cc(/C=C/C=C(\C#N)C(=O)NCc2cccc(F)c2)ccc1O |
| InChI | InChI=1S/C20H17FN2O3/c1-26-19-11-14(8-9-18(19)24)4-2-6-16(12-22)20(25)23-13-15-5-3-7-17(21)10-15/h2-11,24H,13H2,1H3,(H,23,25)/b4-2+,16-6+ |
| InChIKey | FGJOCTWMHCSXBD-NKJMRRHMSA-N |
| XLogP | 3.32 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|