C23H24N2O4 — CID 10157333
(2E,4E)-2-cyano-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide (PubChem CID 10157333) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-2-cyano-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 10157333 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2E,4E)-2-cyano-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide |
| SMILES | COc1cc(/C=C/C=C(\C#N)C(=O)NCCCc2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C23H24N2O4/c1-28-20-14-18(15-21(29-2)22(20)26)10-6-12-19(16-24)23(27)25-13-7-11-17-8-4-3-5-9-17/h3-6,8-10,12,14-15,26H,7,11,13H2,1-2H3,(H,25,27)/b10-6+,19-12+ |
| InChIKey | QOSXQPURDGOCPG-ATFGCDJJSA-N |
| XLogP | 3.62 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|