C20H19N3O3 — CID 59987138
(2E,4E)-2-cyano-5-(4-hydroxy-3-methoxyphenyl)-N-(2-pyridin-3-ylethyl)penta-2,4-dienamide (PubChem CID 59987138) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-(4-hydroxy-3-methoxyphenyl)-N-(2-pyridin-3-ylethyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-2-cyano-5-(4-hydroxy-3-methoxyphenyl)-N-(2-pyridin-3-ylethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 59987138 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (2E,4E)-2-cyano-5-(4-hydroxy-3-methoxyphenyl)-N-(2-pyridin-3-ylethyl)penta-2,4-dienamide |
| SMILES | COc1cc(/C=C/C=C(\C#N)C(=O)NCCc2cccnc2)ccc1O |
| InChI | InChI=1S/C20H19N3O3/c1-26-19-12-15(7-8-18(19)24)4-2-6-17(13-21)20(25)23-11-9-16-5-3-10-22-14-16/h2-8,10,12,14,24H,9,11H2,1H3,(H,23,25)/b4-2+,17-6+ |
| InChIKey | ZLLFNCYTXXHSTO-BZAMGBJESA-N |
| XLogP | 2.62 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|