C27H36N2O3 — CID 143199653
(2E,4E,6E)-2-cyano-7-(4-hydroxy-3-methoxyphenyl)-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hepta-2,4,6-trienamide;ethane (PubChem CID 143199653) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is (2E,4E,6E)-2-cyano-7-(4-hydroxy-3-methoxyphenyl)-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hepta-2,4,6-trienamide;ethane.
| Compound Name | (2E,4E,6E)-2-cyano-7-(4-hydroxy-3-methoxyphenyl)-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hepta-2,4,6-trienamide;ethane |
|---|---|
| PubChem CID | 143199653 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (2E,4E,6E)-2-cyano-7-(4-hydroxy-3-methoxyphenyl)-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hepta-2,4,6-trienamide;ethane |
| SMILES | C=C/C=C(\C=C/C)CNC(=O)/C(C#N)=C/C=C/C=C/c1ccc(O)c(OC)c1.CC.CC |
| InChI | InChI=1S/C23H24N2O3.2C2H6/c1-4-9-19(10-5-2)17-25-23(27)20(16-24)12-8-6-7-11-18-13-14-21(26)22(15-18)28-3;2*1-2/h4-15,26H,1,17H2,2-3H3,(H,25,27);2*1-2H3/b8-6+,10-5-,11-7+,19-9+,20-12+;; |
| InChIKey | BYXFGZAAUKCVRQ-JOJQCRRCSA-N |
| XLogP | 6.28 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|