C21H20B2N2O5S2 — CID 23521819
CID 23521819 (PubChem CID 23521819) has the molecular formula C21H20B2N2O5S2 and a molecular weight of 466.16 g/mol.
| Compound Name | CID 23521819 |
|---|---|
| PubChem CID | 23521819 |
| Molecular Formula | C21H20B2N2O5S2 |
| Molecular Weight | 466.16 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | — |
| SMILES | C[B]SOc1ccc(/C=C/C=C(\C#N)C(=O)NCc2ccc(O)c(O)c2)cc1OS[B]C |
| InChI | InChI=1S/C21H20B2N2O5S2/c1-22-31-29-19-9-7-14(11-20(19)30-32-23-2)4-3-5-16(12-24)21(28)25-13-15-6-8-17(26)18(27)10-15/h3-11,26-27H,13H2,1-2H3,(H,25,28)/b4-3+,16-5+ |
| InChIKey | BPEDZLWOOZLQTA-OOWLUYDYSA-N |
| XLogP | 4.27 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|