C21H22B2N2O3S2 — CID 59072703
(2E,4E)-N-benzyl-5-[3,4-bis[[deuterio(methyl)boranyl]sulfanyloxy]phenyl]-2-cyanopenta-2,4-dienamide (PubChem CID 59072703) has the molecular formula C21H22B2N2O3S2 and a molecular weight of 438.19 g/mol. Its IUPAC name is (2E,4E)-N-benzyl-5-[3,4-bis[[deuterio(methyl)boranyl]sulfanyloxy]phenyl]-2-cyanopenta-2,4-dienamide.
| Compound Name | (2E,4E)-N-benzyl-5-[3,4-bis[[deuterio(methyl)boranyl]sulfanyloxy]phenyl]-2-cyanopenta-2,4-dienamide |
|---|---|
| PubChem CID | 59072703 |
| Molecular Formula | C21H22B2N2O3S2 |
| Molecular Weight | 438.19 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (2E,4E)-N-benzyl-5-[3,4-bis[[deuterio(methyl)boranyl]sulfanyloxy]phenyl]-2-cyanopenta-2,4-dienamide |
| SMILES | [2H]B(C)SOc1ccc(/C=C/C=C(\C#N)C(=O)NCc2ccccc2)cc1OSB([2H])C |
| InChI | InChI=1S/C21H22B2N2O3S2/c1-22-29-27-19-12-11-16(13-20(19)28-30-23-2)9-6-10-18(14-24)21(26)25-15-17-7-4-3-5-8-17/h3-13,22-23H,15H2,1-2H3,(H,25,26)/b9-6+,18-10+/i22D,23D |
| InChIKey | RTVJYCFIICPVET-JIANYOMTSA-N |
| XLogP | 4.32 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.19 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|