C23H26N2O2 — CID 143111852
(2E,4E)-2-cyano-5-(4-hydroxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide;ethane (PubChem CID 143111852) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-(4-hydroxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide;ethane.
| Compound Name | (2E,4E)-2-cyano-5-(4-hydroxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 143111852 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2E,4E)-2-cyano-5-(4-hydroxyphenyl)-N-(3-phenylpropyl)penta-2,4-dienamide;ethane |
| SMILES | CC.N#C/C(=C\C=C\c1ccc(O)cc1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H20N2O2.C2H6/c22-16-19(10-4-8-18-11-13-20(24)14-12-18)21(25)23-15-5-9-17-6-2-1-3-7-17;1-2/h1-4,6-8,10-14,24H,5,9,15H2,(H,23,25);1-2H3/b8-4+,19-10+; |
| InChIKey | LNRSMEKSLTUBIY-BYYPSOHLSA-N |
| XLogP | 4.63 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|