C18H18N4O — CID 3476582
2-cyano-N-(3-imidazol-1-ylpropyl)-5-phenylpenta-2,4-dienamide (PubChem CID 3476582) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-cyano-N-(3-imidazol-1-ylpropyl)-5-phenylpenta-2,4-dienamide.
| Compound Name | 2-cyano-N-(3-imidazol-1-ylpropyl)-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 3476582 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-cyano-N-(3-imidazol-1-ylpropyl)-5-phenylpenta-2,4-dienamide |
| SMILES | N#CC(=CC=Cc1ccccc1)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C18H18N4O/c19-14-17(9-4-8-16-6-2-1-3-7-16)18(23)21-10-5-12-22-13-11-20-15-22/h1-4,6-9,11,13,15H,5,10,12H2,(H,21,23) |
| InChIKey | AHAUGBAGBZNWNT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|