C23H24N4O2 — CID 73202237
benzene;2-cyano-N-(3-imidazol-1-ylpropyl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 73202237) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is benzene;2-cyano-N-(3-imidazol-1-ylpropyl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | benzene;2-cyano-N-(3-imidazol-1-ylpropyl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 73202237 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | benzene;2-cyano-N-(3-imidazol-1-ylpropyl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=C(C#N)C(=O)NCCCn2ccnc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C17H18N4O2.C6H6/c1-23-16-5-3-14(4-6-16)11-15(12-18)17(22)20-7-2-9-21-10-8-19-13-21;1-2-4-6-5-3-1/h3-6,8,10-11,13H,2,7,9H2,1H3,(H,20,22);1-6H |
| InChIKey | LIUCGMQCDSVCPX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|