C17H12FN — CID 20836458
(2E,4Z)-2-(4-fluorophenyl)-5-phenylpenta-2,4-dienenitrile (PubChem CID 20836458) has the molecular formula C17H12FN and a molecular weight of 249.29 g/mol. Its IUPAC name is (2E,4Z)-2-(4-fluorophenyl)-5-phenylpenta-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2-(4-fluorophenyl)-5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 20836458 |
| Molecular Formula | C17H12FN |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2E,4Z)-2-(4-fluorophenyl)-5-phenylpenta-2,4-dienenitrile |
| SMILES | N#C/C(=C/C=C\c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12FN/c18-17-11-9-15(10-12-17)16(13-19)8-4-7-14-5-2-1-3-6-14/h1-12H/b7-4-,16-8- |
| InChIKey | QGVOKVHULDCKGJ-HASPRUBHSA-N |
| XLogP | 4.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|