C20H14N2Se — CID 178066109
(2E,4E)-5-phenyl-2-(4-phenyl-1,3-selenazol-2-yl)penta-2,4-dienenitrile (PubChem CID 178066109) has the molecular formula C20H14N2Se and a molecular weight of 361.31 g/mol. Its IUPAC name is (2E,4E)-5-phenyl-2-(4-phenyl-1,3-selenazol-2-yl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-phenyl-2-(4-phenyl-1,3-selenazol-2-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 178066109 |
| Molecular Formula | C20H14N2Se |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (2E,4E)-5-phenyl-2-(4-phenyl-1,3-selenazol-2-yl)penta-2,4-dienenitrile |
| SMILES | N#C/C(=C\C=C\c1ccccc1)c1nc(-c2ccccc2)c[se]1 |
| InChI | InChI=1S/C20H14N2Se/c21-14-18(13-7-10-16-8-3-1-4-9-16)20-22-19(15-23-20)17-11-5-2-6-12-17/h1-13,15H/b10-7+,18-13+ |
| InChIKey | FIVLKTNNICEZJM-CVUDBVLYSA-N |
| XLogP | 4.43 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|