C22H13BrN2OSe — CID 15326306
(E)-2-[4-(4-bromophenyl)-1,3-selenazol-2-yl]-3-(5-phenylfuran-2-yl)prop-2-enenitrile (PubChem CID 15326306) has the molecular formula C22H13BrN2OSe and a molecular weight of 480.22 g/mol. Its IUPAC name is (E)-2-[4-(4-bromophenyl)-1,3-selenazol-2-yl]-3-(5-phenylfuran-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-bromophenyl)-1,3-selenazol-2-yl]-3-(5-phenylfuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 15326306 |
| Molecular Formula | C22H13BrN2OSe |
| Molecular Weight | 480.22 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | (E)-2-[4-(4-bromophenyl)-1,3-selenazol-2-yl]-3-(5-phenylfuran-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccccc2)o1)c1nc(-c2ccc(Br)cc2)c[se]1 |
| InChI | InChI=1S/C22H13BrN2OSe/c23-18-8-6-15(7-9-18)20-14-27-22(25-20)17(13-24)12-19-10-11-21(26-19)16-4-2-1-3-5-16/h1-12,14H/b17-12+ |
| InChIKey | IOBCEXCTLWGGFU-SFQUDFHCSA-N |
| XLogP | 5.89 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.22 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|