C36H26N2O2 — CID 88857698
(2E,4E)-2-cyano-5-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]penta-2,4-dienoic acid (PubChem CID 88857698) has the molecular formula C36H26N2O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-cyano-5-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88857698 |
| Molecular Formula | C36H26N2O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (2E,4E)-2-cyano-5-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]penta-2,4-dienoic acid |
| SMILES | N#C/C(=C\C=C\c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C36H26N2O2/c37-26-32(36(39)40)13-7-8-27-14-20-33(21-15-27)38(34-22-16-30(17-23-34)28-9-3-1-4-10-28)35-24-18-31(19-25-35)29-11-5-2-6-12-29/h1-25H,(H,39,40)/b8-7+,32-13+ |
| InChIKey | HNTPMPFYZCTSCN-KFVOIWQSSA-N |
| XLogP | 9.04 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|