C29H22N2O2 — CID 102501665
(E)-2-cyano-3-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]prop-2-enoic acid (PubChem CID 102501665) has the molecular formula C29H22N2O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102501665 |
| Molecular Formula | C29H22N2O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (E)-2-cyano-3-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cccc(N(c2ccccc2)c2ccc(-c3ccc(/C=C(\C#N)C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C29H22N2O2/c1-21-6-5-9-28(18-21)31(26-7-3-2-4-8-26)27-16-14-24(15-17-27)23-12-10-22(11-13-23)19-25(20-30)29(32)33/h2-19H,1H3,(H,32,33)/b25-19+ |
| InChIKey | QIIDUNWACSDXNJ-NCELDCMTSA-N |
| XLogP | 7.12 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|