C39H32N2O2 — CID 173467144
(Z)-2-cyano-3-[4-[N-(2,4-dimethylphenyl)-4-[(Z)-2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]prop-2-enoic acid (PubChem CID 173467144) has the molecular formula C39H32N2O2 and a molecular weight of 560.70 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[N-(2,4-dimethylphenyl)-4-[(Z)-2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[4-[N-(2,4-dimethylphenyl)-4-[(Z)-2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 173467144 |
| Molecular Formula | C39H32N2O2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (Z)-2-cyano-3-[4-[N-(2,4-dimethylphenyl)-4-[(Z)-2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(/C(=C\c2ccc(N(c3ccc(/C=C(/C#N)C(=O)O)cc3)c3ccc(C)cc3C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H32N2O2/c1-27-9-16-33(17-10-27)37(32-7-5-4-6-8-32)25-31-14-20-36(21-15-31)41(38-22-11-28(2)23-29(38)3)35-18-12-30(13-19-35)24-34(26-40)39(42)43/h4-25H,1-3H3,(H,42,43)/b34-24-,37-25- |
| InChIKey | UTMKJIXYBKLWOL-OEMNNNJISA-N |
| XLogP | 9.66 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|