C39H32N2O2 — CID 59762718
(E)-3-[4-[N-(2,4-dimethylphenyl)-4-[2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]-2-isocyanoprop-2-enoic acid (PubChem CID 59762718) has the molecular formula C39H32N2O2 and a molecular weight of 560.70 g/mol. Its IUPAC name is (E)-3-[4-[N-(2,4-dimethylphenyl)-4-[2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[N-(2,4-dimethylphenyl)-4-[2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 59762718 |
| Molecular Formula | C39H32N2O2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (E)-3-[4-[N-(2,4-dimethylphenyl)-4-[2-(4-methylphenyl)-2-phenylethenyl]anilino]phenyl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C/c1ccc(N(c2ccc(C=C(c3ccccc3)c3ccc(C)cc3)cc2)c2ccc(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C39H32N2O2/c1-27-10-17-33(18-11-27)36(32-8-6-5-7-9-32)25-30-13-19-34(20-14-30)41(38-23-12-28(2)24-29(38)3)35-21-15-31(16-22-35)26-37(40-4)39(42)43/h5-26H,1-3H3,(H,42,43)/b36-25?,37-26+ |
| InChIKey | YQWDLVCLMXEZDO-SEPAIMGGSA-N |
| XLogP | 10.02 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|