C50H42N4O2 — CID 58660323
(Z)-2-isocyano-3-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)-N-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]anilino]phenyl]prop-2-enoic acid (PubChem CID 58660323) has the molecular formula C50H42N4O2 and a molecular weight of 730.91 g/mol. Its IUPAC name is (Z)-2-isocyano-3-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)-N-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]anilino]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-isocyano-3-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)-N-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]anilino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58660323 |
| Molecular Formula | C50H42N4O2 |
| Molecular Weight | 730.91 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | (Z)-2-isocyano-3-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)-N-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]anilino]phenyl]prop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(N(c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C50H42N4O2/c1-35-6-16-40(17-7-35)52(41-18-8-36(2)9-19-41)45-26-30-47(31-27-45)54(44-24-14-39(15-25-44)34-49(51-5)50(55)56)48-32-28-46(29-33-48)53(42-20-10-37(3)11-21-42)43-22-12-38(4)13-23-43/h6-34H,1-4H3,(H,55,56)/b49-34- |
| InChIKey | FTDBWNSAQBHBPZ-UGZLRZPTSA-N |
| XLogP | 13.67 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.91 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|