C38H26N4O4 — CID 59765902
(E)-3-[4-(N-[4-(N-[4-[(E)-2-carboxy-2-isocyanoethenyl]phenyl]anilino)phenyl]anilino)phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 59765902) has the molecular formula C38H26N4O4 and a molecular weight of 602.65 g/mol. Its IUPAC name is (E)-3-[4-(N-[4-(N-[4-[(E)-2-carboxy-2-isocyanoethenyl]phenyl]anilino)phenyl]anilino)phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-(N-[4-(N-[4-[(E)-2-carboxy-2-isocyanoethenyl]phenyl]anilino)phenyl]anilino)phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 59765902 |
| Molecular Formula | C38H26N4O4 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | (E)-3-[4-(N-[4-(N-[4-[(E)-2-carboxy-2-isocyanoethenyl]phenyl]anilino)phenyl]anilino)phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C/c1ccc(N(c2ccccc2)c2ccc(N(c3ccccc3)c3ccc(/C=C(\C#N)C(=O)O)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C38H26N4O4/c1-40-36(38(45)46)25-28-14-18-33(19-15-28)42(31-10-6-3-7-11-31)35-22-20-34(21-23-35)41(30-8-4-2-5-9-30)32-16-12-27(13-17-32)24-29(26-39)37(43)44/h2-25H,(H,43,44)(H,45,46)/b29-24+,36-25+ |
| InChIKey | XSYRQHVUGHTZRN-MSLSHZORSA-N |
| XLogP | 8.96 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|