C30H20Br2N2O2 — CID 102261433
(E)-3-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 102261433) has the molecular formula C30H20Br2N2O2 and a molecular weight of 600.31 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 102261433 |
| Molecular Formula | C30H20Br2N2O2 |
| Molecular Weight | 600.31 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | (E)-3-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(/C=C/c2ccc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H20Br2N2O2/c31-25-9-15-28(16-10-25)34(29-17-11-26(32)12-18-29)27-13-7-22(8-14-27)2-1-21-3-5-23(6-4-21)19-24(20-33)30(35)36/h1-19H,(H,35,36)/b2-1+,24-19+ |
| InChIKey | NTNXLAPGYNJDGH-ZOTMHGRVSA-N |
| XLogP | 8.84 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.31 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|