C16H16N2O2 — CID 78145372
3-[4-[bis(prop-2-enyl)amino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 78145372) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-[4-[bis(prop-2-enyl)amino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[4-[bis(prop-2-enyl)amino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 78145372 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-[4-[bis(prop-2-enyl)amino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | C=CCN(CC=C)c1ccc(C=C(C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-3-9-18(10-4-2)15-7-5-13(6-8-15)11-14(12-17)16(19)20/h3-8,11H,1-2,9-10H2,(H,19,20) |
| InChIKey | AISGAELWENFDCQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|