C13H15NO3Si — CID 178195372
(E)-2-cyano-3-(4-trimethylsilyloxyphenyl)prop-2-enoic acid (PubChem CID 178195372) has the molecular formula C13H15NO3Si and a molecular weight of 261.35 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-trimethylsilyloxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-(4-trimethylsilyloxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 178195372 |
| Molecular Formula | C13H15NO3Si |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (E)-2-cyano-3-(4-trimethylsilyloxyphenyl)prop-2-enoic acid |
| SMILES | C[Si](C)(C)Oc1ccc(/C=C(\C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO3Si/c1-18(2,3)17-12-6-4-10(5-7-12)8-11(9-14)13(15)16/h4-8H,1-3H3,(H,15,16)/b11-8+ |
| InChIKey | XJRBFFZEJQIHPX-DHZHZOJOSA-N |
| XLogP | 2.89 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|